About azepan-1-yl-[6-[[3-(1,1-difluoroethoxy)phenyl]sulfanylmethyl]-2-pyridinyl]methanone
azepan-1-yl-[6-[[3-(1,1-difluoroethoxy)phenyl]sulfanylmethyl]-2-pyridinyl]methanone (PubChem CID 58211199) has the molecular formula C21H24F2N2O2S
and a molecular weight of 406.50 g/mol. Its IUPAC name is azepan-1-yl-[6-[[3-(1,1-difluoroethoxy)phenyl]sulfanylmethyl]-2-pyridinyl]methanone.
Molecular Properties
| Compound Name | azepan-1-yl-[6-[[3-(1,1-difluoroethoxy)phenyl]sulfanylmethyl]-2-pyridinyl]methanone |
| PubChem CID | 58211199 |
| Molecular Formula | C21H24F2N2O2S |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | azepan-1-yl-[6-[[3-(1,1-difluoroethoxy)phenyl]sulfanylmethyl]-2-pyridinyl]methanone |
| SMILES | CC(F)(F)Oc1cccc(SCc2cccc(C(=O)N3CCCCCC3)n2)c1 |
| InChI | InChI=1S/C21H24F2N2O2S/c1-21(22,23)27-17-9-7-10-18(14-17)28-15-16-8-6-11-19(24-16)20(26)25-12-4-2-3-5-13-25/h6-11,14H,2-5,12-13,15H2,1H3 |
| InChIKey | IGBCPQSJXQISKB-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze azepan-1-yl-[6-[[3-(1,1-difluoroethoxy)phenyl]sulfanylmethyl]-2-pyridinyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azepan-1-yl-[6-[[3-(1,1-difluoroethoxy)phenyl]sulfanylmethyl]-2-pyridinyl]methanone?
The IUPAC name of azepan-1-yl-[6-[[3-(1,1-difluoroethoxy)phenyl]sulfanylmethyl]-2-pyridinyl]methanone (CID 58211199) is azepan-1-yl-[6-[[3-(1,1-difluoroethoxy)phenyl]sulfanylmethyl]-2-pyridinyl]methanone.
What is the SMILES notation for azepan-1-yl-[6-[[3-(1,1-difluoroethoxy)phenyl]sulfanylmethyl]-2-pyridinyl]methanone?
The canonical SMILES for azepan-1-yl-[6-[[3-(1,1-difluoroethoxy)phenyl]sulfanylmethyl]-2-pyridinyl]methanone is CC(F)(F)Oc1cccc(SCc2cccc(C(=O)N3CCCCCC3)n2)c1.
What is the InChIKey of azepan-1-yl-[6-[[3-(1,1-difluoroethoxy)phenyl]sulfanylmethyl]-2-pyridinyl]methanone?
The InChIKey is IGBCPQSJXQISKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24F2N2O2S/c1-21(22,23)27-17-9-7-10-18(14-17)28-15-16-8-6-11-19(24-16)20(26)25-12-4-2-3-5-13-25/h6-11,14H,2-5,12-13,15H2,1H3.
What are the key properties of azepan-1-yl-[6-[[3-(1,1-difluoroethoxy)phenyl]sulfanylmethyl]-2-pyridinyl]methanone?
azepan-1-yl-[6-[[3-(1,1-difluoroethoxy)phenyl]sulfanylmethyl]-2-pyridinyl]methanone has a molecular weight of 406.50 g/mol, XLogP of 5.38, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azepan-1-yl-[6-[[3-(1,1-difluoroethoxy)phenyl]sulfanylmethyl]-2-pyridinyl]methanone is sourced from PubChem (CID 58211199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).