About [4-[6-[4-(1,3-oxazol-5-yl)piperidin-1-yl]sulfonyl-2-pyridinyl]phenyl]methanamine
[4-[6-[4-(1,3-oxazol-5-yl)piperidin-1-yl]sulfonyl-2-pyridinyl]phenyl]methanamine (PubChem CID 58211257) has the molecular formula C20H22N4O3S
and a molecular weight of 398.49 g/mol. Its IUPAC name is [4-[6-[4-(1,3-oxazol-5-yl)piperidin-1-yl]sulfonyl-2-pyridinyl]phenyl]methanamine.
Molecular Properties
| Compound Name | [4-[6-[4-(1,3-oxazol-5-yl)piperidin-1-yl]sulfonyl-2-pyridinyl]phenyl]methanamine |
| PubChem CID | 58211257 |
| Molecular Formula | C20H22N4O3S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | [4-[6-[4-(1,3-oxazol-5-yl)piperidin-1-yl]sulfonyl-2-pyridinyl]phenyl]methanamine |
| SMILES | NCc1ccc(-c2cccc(S(=O)(=O)N3CCC(c4cnco4)CC3)n2)cc1 |
| InChI | InChI=1S/C20H22N4O3S/c21-12-15-4-6-16(7-5-15)18-2-1-3-20(23-18)28(25,26)24-10-8-17(9-11-24)19-13-22-14-27-19/h1-7,13-14,17H,8-12,21H2 |
| InChIKey | IACMUFTVQPKVEC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-[6-[4-(1,3-oxazol-5-yl)piperidin-1-yl]sulfonyl-2-pyridinyl]phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[6-[4-(1,3-oxazol-5-yl)piperidin-1-yl]sulfonyl-2-pyridinyl]phenyl]methanamine?
The IUPAC name of [4-[6-[4-(1,3-oxazol-5-yl)piperidin-1-yl]sulfonyl-2-pyridinyl]phenyl]methanamine (CID 58211257) is [4-[6-[4-(1,3-oxazol-5-yl)piperidin-1-yl]sulfonyl-2-pyridinyl]phenyl]methanamine.
What is the SMILES notation for [4-[6-[4-(1,3-oxazol-5-yl)piperidin-1-yl]sulfonyl-2-pyridinyl]phenyl]methanamine?
The canonical SMILES for [4-[6-[4-(1,3-oxazol-5-yl)piperidin-1-yl]sulfonyl-2-pyridinyl]phenyl]methanamine is NCc1ccc(-c2cccc(S(=O)(=O)N3CCC(c4cnco4)CC3)n2)cc1.
What is the InChIKey of [4-[6-[4-(1,3-oxazol-5-yl)piperidin-1-yl]sulfonyl-2-pyridinyl]phenyl]methanamine?
The InChIKey is IACMUFTVQPKVEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N4O3S/c21-12-15-4-6-16(7-5-15)18-2-1-3-20(23-18)28(25,26)24-10-8-17(9-11-24)19-13-22-14-27-19/h1-7,13-14,17H,8-12,21H2.
What are the key properties of [4-[6-[4-(1,3-oxazol-5-yl)piperidin-1-yl]sulfonyl-2-pyridinyl]phenyl]methanamine?
[4-[6-[4-(1,3-oxazol-5-yl)piperidin-1-yl]sulfonyl-2-pyridinyl]phenyl]methanamine has a molecular weight of 398.49 g/mol, XLogP of 2.76, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[6-[4-(1,3-oxazol-5-yl)piperidin-1-yl]sulfonyl-2-pyridinyl]phenyl]methanamine is sourced from PubChem (CID 58211257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).