About 1-butyl-4-(2,4-dichlorophenyl)-2-[(E)-2-[4-(4-methoxyphenyl)phenyl]ethenyl]imidazole
1-butyl-4-(2,4-dichlorophenyl)-2-[(E)-2-[4-(4-methoxyphenyl)phenyl]ethenyl]imidazole (PubChem CID 58211809) has the molecular formula C28H26Cl2N2O
and a molecular weight of 477.44 g/mol. Its IUPAC name is 1-butyl-4-(2,4-dichlorophenyl)-2-[(E)-2-[4-(4-methoxyphenyl)phenyl]ethenyl]imidazole.
Molecular Properties
| Compound Name | 1-butyl-4-(2,4-dichlorophenyl)-2-[(E)-2-[4-(4-methoxyphenyl)phenyl]ethenyl]imidazole |
| PubChem CID | 58211809 |
| Molecular Formula | C28H26Cl2N2O |
| Molecular Weight | 477.44 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | 1-butyl-4-(2,4-dichlorophenyl)-2-[(E)-2-[4-(4-methoxyphenyl)phenyl]ethenyl]imidazole |
| SMILES | CCCCn1cc(-c2ccc(Cl)cc2Cl)nc1/C=C/c1ccc(-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C28H26Cl2N2O/c1-3-4-17-32-19-27(25-15-12-23(29)18-26(25)30)31-28(32)16-7-20-5-8-21(9-6-20)22-10-13-24(33-2)14-11-22/h5-16,18-19H,3-4,17H2,1-2H3/b16-7+ |
| InChIKey | IYNBCDWPMNKHTR-FRKPEAEDSA-N |
| XLogP | 8.50 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 477.44 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-butyl-4-(2,4-dichlorophenyl)-2-[(E)-2-[4-(4-methoxyphenyl)phenyl]ethenyl]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-4-(2,4-dichlorophenyl)-2-[(E)-2-[4-(4-methoxyphenyl)phenyl]ethenyl]imidazole?
The IUPAC name of 1-butyl-4-(2,4-dichlorophenyl)-2-[(E)-2-[4-(4-methoxyphenyl)phenyl]ethenyl]imidazole (CID 58211809) is 1-butyl-4-(2,4-dichlorophenyl)-2-[(E)-2-[4-(4-methoxyphenyl)phenyl]ethenyl]imidazole.
What is the SMILES notation for 1-butyl-4-(2,4-dichlorophenyl)-2-[(E)-2-[4-(4-methoxyphenyl)phenyl]ethenyl]imidazole?
The canonical SMILES for 1-butyl-4-(2,4-dichlorophenyl)-2-[(E)-2-[4-(4-methoxyphenyl)phenyl]ethenyl]imidazole is CCCCn1cc(-c2ccc(Cl)cc2Cl)nc1/C=C/c1ccc(-c2ccc(OC)cc2)cc1.
What is the InChIKey of 1-butyl-4-(2,4-dichlorophenyl)-2-[(E)-2-[4-(4-methoxyphenyl)phenyl]ethenyl]imidazole?
The InChIKey is IYNBCDWPMNKHTR-FRKPEAEDSA-N. The full InChI is InChI=1S/C28H26Cl2N2O/c1-3-4-17-32-19-27(25-15-12-23(29)18-26(25)30)31-28(32)16-7-20-5-8-21(9-6-20)22-10-13-24(33-2)14-11-22/h5-16,18-19H,3-4,17H2,1-2H3/b16-7+.
What are the key properties of 1-butyl-4-(2,4-dichlorophenyl)-2-[(E)-2-[4-(4-methoxyphenyl)phenyl]ethenyl]imidazole?
1-butyl-4-(2,4-dichlorophenyl)-2-[(E)-2-[4-(4-methoxyphenyl)phenyl]ethenyl]imidazole has a molecular weight of 477.44 g/mol, XLogP of 8.50, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-4-(2,4-dichlorophenyl)-2-[(E)-2-[4-(4-methoxyphenyl)phenyl]ethenyl]imidazole is sourced from PubChem (CID 58211809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).