C29H23Cl2F3N2O3 — CID 58211910
4-[4-[4-[(E)-2-[4-(2,4-dichlorophenyl)-1-(2,2,2-trifluoroethyl)imidazol-2-yl]ethenyl]phenyl]phenoxy]butanoic acid (PubChem CID 58211910) has the molecular formula C29H23Cl2F3N2O3 and a molecular weight of 575.41 g/mol. Its IUPAC name is 4-[4-[4-[(E)-2-[4-(2,4-dichlorophenyl)-1-(2,2,2-trifluoroethyl)imidazol-2-yl]ethenyl]phenyl]phenoxy]butanoic acid.
| Compound Name | 4-[4-[4-[(E)-2-[4-(2,4-dichlorophenyl)-1-(2,2,2-trifluoroethyl)imidazol-2-yl]ethenyl]phenyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 58211910 |
| Molecular Formula | C29H23Cl2F3N2O3 |
| Molecular Weight | 575.41 g/mol |
| Exact Mass | 574.10 |
| IUPAC Name | 4-[4-[4-[(E)-2-[4-(2,4-dichlorophenyl)-1-(2,2,2-trifluoroethyl)imidazol-2-yl]ethenyl]phenyl]phenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1ccc(-c2ccc(/C=C/c3nc(-c4ccc(Cl)cc4Cl)cn3CC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C29H23Cl2F3N2O3/c30-22-10-13-24(25(31)16-22)26-17-36(18-29(32,33)34)27(35-26)14-5-19-3-6-20(7-4-19)21-8-11-23(12-9-21)39-15-1-2-28(37)38/h3-14,16-17H,1-2,15,18H2,(H,37,38)/b14-5+ |
| InChIKey | MXJPKUAGKDOOQX-LHHJGKSTSA-N |
| XLogP | 8.50 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.41 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|