About 3-[5-(6-fluoro-5-methyl-3-pyridinyl)-1,2,4-oxadiazol-3-yl]phenol
3-[5-(6-fluoro-5-methyl-3-pyridinyl)-1,2,4-oxadiazol-3-yl]phenol (PubChem CID 58212400) has the molecular formula C14H10FN3O2
and a molecular weight of 271.25 g/mol. Its IUPAC name is 3-[5-(6-fluoro-5-methyl-3-pyridinyl)-1,2,4-oxadiazol-3-yl]phenol.
Molecular Properties
| Compound Name | 3-[5-(6-fluoro-5-methyl-3-pyridinyl)-1,2,4-oxadiazol-3-yl]phenol |
| PubChem CID | 58212400 |
| Molecular Formula | C14H10FN3O2 |
| Molecular Weight | 271.25 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 3-[5-(6-fluoro-5-methyl-3-pyridinyl)-1,2,4-oxadiazol-3-yl]phenol |
| SMILES | Cc1cc(-c2nc(-c3cccc(O)c3)no2)cnc1F |
| InChI | InChI=1S/C14H10FN3O2/c1-8-5-10(7-16-12(8)15)14-17-13(18-20-14)9-3-2-4-11(19)6-9/h2-7,19H,1H3 |
| InChIKey | VMEYWZGKLURFDD-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 72.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.25 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3-[5-(6-fluoro-5-methyl-3-pyridinyl)-1,2,4-oxadiazol-3-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(6-fluoro-5-methyl-3-pyridinyl)-1,2,4-oxadiazol-3-yl]phenol?
The IUPAC name of 3-[5-(6-fluoro-5-methyl-3-pyridinyl)-1,2,4-oxadiazol-3-yl]phenol (CID 58212400) is 3-[5-(6-fluoro-5-methyl-3-pyridinyl)-1,2,4-oxadiazol-3-yl]phenol.
What is the SMILES notation for 3-[5-(6-fluoro-5-methyl-3-pyridinyl)-1,2,4-oxadiazol-3-yl]phenol?
The canonical SMILES for 3-[5-(6-fluoro-5-methyl-3-pyridinyl)-1,2,4-oxadiazol-3-yl]phenol is Cc1cc(-c2nc(-c3cccc(O)c3)no2)cnc1F.
What is the InChIKey of 3-[5-(6-fluoro-5-methyl-3-pyridinyl)-1,2,4-oxadiazol-3-yl]phenol?
The InChIKey is VMEYWZGKLURFDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10FN3O2/c1-8-5-10(7-16-12(8)15)14-17-13(18-20-14)9-3-2-4-11(19)6-9/h2-7,19H,1H3.
What are the key properties of 3-[5-(6-fluoro-5-methyl-3-pyridinyl)-1,2,4-oxadiazol-3-yl]phenol?
3-[5-(6-fluoro-5-methyl-3-pyridinyl)-1,2,4-oxadiazol-3-yl]phenol has a molecular weight of 271.25 g/mol, XLogP of 2.95, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(6-fluoro-5-methyl-3-pyridinyl)-1,2,4-oxadiazol-3-yl]phenol is sourced from PubChem (CID 58212400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).