C26H40N2O8S — CID 58212999
tert-butyl 2-[(1S,4R,6S,7Z,14R,18R)-18-hydroxy-4-(methylsulfonylcarbamoyl)-2,15-dioxo-16-azatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]acetate (PubChem CID 58212999) has the molecular formula C26H40N2O8S and a molecular weight of 540.68 g/mol. Its IUPAC name is tert-butyl 2-[(1S,4R,6S,7Z,14R,18R)-18-hydroxy-4-(methylsulfonylcarbamoyl)-2,15-dioxo-16-azatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]acetate.
| Compound Name | tert-butyl 2-[(1S,4R,6S,7Z,14R,18R)-18-hydroxy-4-(methylsulfonylcarbamoyl)-2,15-dioxo-16-azatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]acetate |
|---|---|
| PubChem CID | 58212999 |
| Molecular Formula | C26H40N2O8S |
| Molecular Weight | 540.68 g/mol |
| Exact Mass | 540.25 |
| IUPAC Name | tert-butyl 2-[(1S,4R,6S,7Z,14R,18R)-18-hydroxy-4-(methylsulfonylcarbamoyl)-2,15-dioxo-16-azatricyclo[14.3.0.04,6]nonadec-7-en-14-yl]acetate |
| SMILES | CC(C)(C)OC(=O)C[C@H]1CCCCC/C=C\[C@@H]2C[C@@]2(C(=O)NS(C)(=O)=O)CC(=O)[C@@H]2C[C@@H](O)CN2C1=O |
| InChI | InChI=1S/C26H40N2O8S/c1-25(2,3)36-22(31)12-17-10-8-6-5-7-9-11-18-14-26(18,24(33)27-37(4,34)35)15-21(30)20-13-19(29)16-28(20)23(17)32/h9,11,17-20,29H,5-8,10,12-16H2,1-4H3,(H,27,33)/b11-9-/t17-,18-,19-,20+,26-/m1/s1 |
| InChIKey | GCFVESKDSFAPQJ-PLCZUIAYSA-N |
| XLogP | 1.86 |
| TPSA | 147.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.68 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|