C30H22F6O9S2 — CID 58214183
2-[4-[1,1,1,3,3,3-hexafluoro-2-(4-methoxy-3-sulfophenyl)propan-2-yl]phenoxy]-5-(4-methylbenzoyl)benzenesulfonic acid (PubChem CID 58214183) has the molecular formula C30H22F6O9S2 and a molecular weight of 704.62 g/mol. Its IUPAC name is 2-[4-[1,1,1,3,3,3-hexafluoro-2-(4-methoxy-3-sulfophenyl)propan-2-yl]phenoxy]-5-(4-methylbenzoyl)benzenesulfonic acid.
| Compound Name | 2-[4-[1,1,1,3,3,3-hexafluoro-2-(4-methoxy-3-sulfophenyl)propan-2-yl]phenoxy]-5-(4-methylbenzoyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 58214183 |
| Molecular Formula | C30H22F6O9S2 |
| Molecular Weight | 704.62 g/mol |
| Exact Mass | 704.06 |
| IUPAC Name | 2-[4-[1,1,1,3,3,3-hexafluoro-2-(4-methoxy-3-sulfophenyl)propan-2-yl]phenoxy]-5-(4-methylbenzoyl)benzenesulfonic acid |
| SMILES | COc1ccc(C(c2ccc(Oc3ccc(C(=O)c4ccc(C)cc4)cc3S(=O)(=O)O)cc2)(C(F)(F)F)C(F)(F)F)cc1S(=O)(=O)O |
| InChI | InChI=1S/C30H22F6O9S2/c1-17-3-5-18(6-4-17)27(37)19-7-13-24(25(15-19)46(38,39)40)45-22-11-8-20(9-12-22)28(29(31,32)33,30(34,35)36)21-10-14-23(44-2)26(16-21)47(41,42)43/h3-16H,1-2H3,(H,38,39,40)(H,41,42,43) |
| InChIKey | VCRPWNHCODFHBI-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 144.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.62 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|