About N'-[2,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]-N-ethyl-N-methylmethanimidamide
N'-[2,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 58214412) has the molecular formula C19H21F3N2
and a molecular weight of 334.39 g/mol. Its IUPAC name is N'-[2,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]-N-ethyl-N-methylmethanimidamide.
Molecular Properties
| Compound Name | N'-[2,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]-N-ethyl-N-methylmethanimidamide |
| PubChem CID | 58214412 |
| Molecular Formula | C19H21F3N2 |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | N'-[2,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(-c2ccc(C(F)(F)F)cc2)cc1C |
| InChI | InChI=1S/C19H21F3N2/c1-5-24(4)12-23-18-11-13(2)17(10-14(18)3)15-6-8-16(9-7-15)19(20,21)22/h6-12H,5H2,1-4H3/b23-12+ |
| InChIKey | UUBSCWQKYYLQFE-FSJBWODESA-N |
| XLogP | 5.60 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[2,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]-N-ethyl-N-methylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]-N-ethyl-N-methylmethanimidamide?
The IUPAC name of N'-[2,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]-N-ethyl-N-methylmethanimidamide (CID 58214412) is N'-[2,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]-N-ethyl-N-methylmethanimidamide.
What is the SMILES notation for N'-[2,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]-N-ethyl-N-methylmethanimidamide?
The canonical SMILES for N'-[2,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]-N-ethyl-N-methylmethanimidamide is CCN(C)/C=N/c1cc(C)c(-c2ccc(C(F)(F)F)cc2)cc1C.
What is the InChIKey of N'-[2,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]-N-ethyl-N-methylmethanimidamide?
The InChIKey is UUBSCWQKYYLQFE-FSJBWODESA-N. The full InChI is InChI=1S/C19H21F3N2/c1-5-24(4)12-23-18-11-13(2)17(10-14(18)3)15-6-8-16(9-7-15)19(20,21)22/h6-12H,5H2,1-4H3/b23-12+.
What are the key properties of N'-[2,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]-N-ethyl-N-methylmethanimidamide?
N'-[2,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]-N-ethyl-N-methylmethanimidamide has a molecular weight of 334.39 g/mol, XLogP of 5.60, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]-N-ethyl-N-methylmethanimidamide is sourced from PubChem (CID 58214412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).