C16H19Cl2N3OS — CID 58214427
N'-[4-[(4,5-dichloro-1,3-thiazol-2-yl)oxy]-2,5-dimethylphenyl]-N-methyl-N-propan-2-ylmethanimidamide (PubChem CID 58214427) has the molecular formula C16H19Cl2N3OS and a molecular weight of 372.32 g/mol. Its IUPAC name is N'-[4-[(4,5-dichloro-1,3-thiazol-2-yl)oxy]-2,5-dimethylphenyl]-N-methyl-N-propan-2-ylmethanimidamide.
| Compound Name | N'-[4-[(4,5-dichloro-1,3-thiazol-2-yl)oxy]-2,5-dimethylphenyl]-N-methyl-N-propan-2-ylmethanimidamide |
|---|---|
| PubChem CID | 58214427 |
| Molecular Formula | C16H19Cl2N3OS |
| Molecular Weight | 372.32 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | N'-[4-[(4,5-dichloro-1,3-thiazol-2-yl)oxy]-2,5-dimethylphenyl]-N-methyl-N-propan-2-ylmethanimidamide |
| SMILES | Cc1cc(Oc2nc(Cl)c(Cl)s2)c(C)cc1/N=C/N(C)C(C)C |
| InChI | InChI=1S/C16H19Cl2N3OS/c1-9(2)21(5)8-19-12-6-11(4)13(7-10(12)3)22-16-20-14(17)15(18)23-16/h6-9H,1-5H3/b19-8+ |
| InChIKey | BBKXDRBBYIXGDV-UFWORHAWSA-N |
| XLogP | 5.86 |
| TPSA | 37.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.32 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|