C19H22O9S — CID 58214606
prop-2-enyl 3-[(3aR,4R,6R,6aR)-2-oxo-4-phenylmethoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-methylsulfonylpropanoate (PubChem CID 58214606) has the molecular formula C19H22O9S and a molecular weight of 426.44 g/mol. Its IUPAC name is prop-2-enyl 3-[(3aR,4R,6R,6aR)-2-oxo-4-phenylmethoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-methylsulfonylpropanoate.
| Compound Name | prop-2-enyl 3-[(3aR,4R,6R,6aR)-2-oxo-4-phenylmethoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-methylsulfonylpropanoate |
|---|---|
| PubChem CID | 58214606 |
| Molecular Formula | C19H22O9S |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | prop-2-enyl 3-[(3aR,4R,6R,6aR)-2-oxo-4-phenylmethoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-methylsulfonylpropanoate |
| SMILES | C=CCOC(=O)C(C[C@H]1O[C@@H](OCc2ccccc2)[C@@H]2OC(=O)O[C@@H]21)S(C)(=O)=O |
| InChI | InChI=1S/C19H22O9S/c1-3-9-24-17(20)14(29(2,22)23)10-13-15-16(28-19(21)27-15)18(26-13)25-11-12-7-5-4-6-8-12/h3-8,13-16,18H,1,9-11H2,2H3/t13-,14?,15-,16-,18-/m1/s1 |
| InChIKey | AUTVVCHFOQNRIG-NMFAUEMESA-N |
| XLogP | 1.36 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|