C17H16FN3O2 — CID 58214854
(E)-N-(diaminomethylidene)-3-[4-(2-fluoro-5-hydroxyphenyl)phenyl]-2-methylprop-2-enamide (PubChem CID 58214854) has the molecular formula C17H16FN3O2 and a molecular weight of 313.33 g/mol. Its IUPAC name is (E)-N-(diaminomethylidene)-3-[4-(2-fluoro-5-hydroxyphenyl)phenyl]-2-methylprop-2-enamide.
| Compound Name | (E)-N-(diaminomethylidene)-3-[4-(2-fluoro-5-hydroxyphenyl)phenyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 58214854 |
| Molecular Formula | C17H16FN3O2 |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | (E)-N-(diaminomethylidene)-3-[4-(2-fluoro-5-hydroxyphenyl)phenyl]-2-methylprop-2-enamide |
| SMILES | C/C(=C\c1ccc(-c2cc(O)ccc2F)cc1)C(=O)N=C(N)N |
| InChI | InChI=1S/C17H16FN3O2/c1-10(16(23)21-17(19)20)8-11-2-4-12(5-3-11)14-9-13(22)6-7-15(14)18/h2-9,22H,1H3,(H4,19,20,21,23)/b10-8+ |
| InChIKey | REWLBECKNOTGGN-CSKARUKUSA-N |
| XLogP | 2.40 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|