About [5-(1-methylindol-2-yl)-3-pyridinyl] morpholine-4-sulfonate
[5-(1-methylindol-2-yl)-3-pyridinyl] morpholine-4-sulfonate (PubChem CID 58215570) has the molecular formula C18H19N3O4S
and a molecular weight of 373.43 g/mol. Its IUPAC name is [5-(1-methylindol-2-yl)-3-pyridinyl] morpholine-4-sulfonate.
Molecular Properties
| Compound Name | [5-(1-methylindol-2-yl)-3-pyridinyl] morpholine-4-sulfonate |
| PubChem CID | 58215570 |
| Molecular Formula | C18H19N3O4S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | [5-(1-methylindol-2-yl)-3-pyridinyl] morpholine-4-sulfonate |
| SMILES | Cn1c(-c2cncc(OS(=O)(=O)N3CCOCC3)c2)cc2ccccc21 |
| InChI | InChI=1S/C18H19N3O4S/c1-20-17-5-3-2-4-14(17)11-18(20)15-10-16(13-19-12-15)25-26(22,23)21-6-8-24-9-7-21/h2-5,10-13H,6-9H2,1H3 |
| InChIKey | VNYFFUZIDORNOR-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [5-(1-methylindol-2-yl)-3-pyridinyl] morpholine-4-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(1-methylindol-2-yl)-3-pyridinyl] morpholine-4-sulfonate?
The IUPAC name of [5-(1-methylindol-2-yl)-3-pyridinyl] morpholine-4-sulfonate (CID 58215570) is [5-(1-methylindol-2-yl)-3-pyridinyl] morpholine-4-sulfonate.
What is the SMILES notation for [5-(1-methylindol-2-yl)-3-pyridinyl] morpholine-4-sulfonate?
The canonical SMILES for [5-(1-methylindol-2-yl)-3-pyridinyl] morpholine-4-sulfonate is Cn1c(-c2cncc(OS(=O)(=O)N3CCOCC3)c2)cc2ccccc21.
What is the InChIKey of [5-(1-methylindol-2-yl)-3-pyridinyl] morpholine-4-sulfonate?
The InChIKey is VNYFFUZIDORNOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3O4S/c1-20-17-5-3-2-4-14(17)11-18(20)15-10-16(13-19-12-15)25-26(22,23)21-6-8-24-9-7-21/h2-5,10-13H,6-9H2,1H3.
What are the key properties of [5-(1-methylindol-2-yl)-3-pyridinyl] morpholine-4-sulfonate?
[5-(1-methylindol-2-yl)-3-pyridinyl] morpholine-4-sulfonate has a molecular weight of 373.43 g/mol, XLogP of 2.20, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(1-methylindol-2-yl)-3-pyridinyl] morpholine-4-sulfonate is sourced from PubChem (CID 58215570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).