About methyl 4-[2-[3,6-dimethyl-2-oxo-4-(trifluoromethylsulfonyloxy)-1-pyridinyl]ethyl]benzoate
methyl 4-[2-[3,6-dimethyl-2-oxo-4-(trifluoromethylsulfonyloxy)-1-pyridinyl]ethyl]benzoate (PubChem CID 58216099) has the molecular formula C18H18F3NO6S
and a molecular weight of 433.40 g/mol. Its IUPAC name is methyl 4-[2-[3,6-dimethyl-2-oxo-4-(trifluoromethylsulfonyloxy)-1-pyridinyl]ethyl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[2-[3,6-dimethyl-2-oxo-4-(trifluoromethylsulfonyloxy)-1-pyridinyl]ethyl]benzoate |
| PubChem CID | 58216099 |
| Molecular Formula | C18H18F3NO6S |
| Molecular Weight | 433.40 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | methyl 4-[2-[3,6-dimethyl-2-oxo-4-(trifluoromethylsulfonyloxy)-1-pyridinyl]ethyl]benzoate |
| SMILES | COC(=O)c1ccc(CCn2c(C)cc(OS(=O)(=O)C(F)(F)F)c(C)c2=O)cc1 |
| InChI | InChI=1S/C18H18F3NO6S/c1-11-10-15(28-29(25,26)18(19,20)21)12(2)16(23)22(11)9-8-13-4-6-14(7-5-13)17(24)27-3/h4-7,10H,8-9H2,1-3H3 |
| InChIKey | MRMAOLFCKMIXPI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 91.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[2-[3,6-dimethyl-2-oxo-4-(trifluoromethylsulfonyloxy)-1-pyridinyl]ethyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[2-[3,6-dimethyl-2-oxo-4-(trifluoromethylsulfonyloxy)-1-pyridinyl]ethyl]benzoate?
The IUPAC name of methyl 4-[2-[3,6-dimethyl-2-oxo-4-(trifluoromethylsulfonyloxy)-1-pyridinyl]ethyl]benzoate (CID 58216099) is methyl 4-[2-[3,6-dimethyl-2-oxo-4-(trifluoromethylsulfonyloxy)-1-pyridinyl]ethyl]benzoate.
What is the SMILES notation for methyl 4-[2-[3,6-dimethyl-2-oxo-4-(trifluoromethylsulfonyloxy)-1-pyridinyl]ethyl]benzoate?
The canonical SMILES for methyl 4-[2-[3,6-dimethyl-2-oxo-4-(trifluoromethylsulfonyloxy)-1-pyridinyl]ethyl]benzoate is COC(=O)c1ccc(CCn2c(C)cc(OS(=O)(=O)C(F)(F)F)c(C)c2=O)cc1.
What is the InChIKey of methyl 4-[2-[3,6-dimethyl-2-oxo-4-(trifluoromethylsulfonyloxy)-1-pyridinyl]ethyl]benzoate?
The InChIKey is MRMAOLFCKMIXPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18F3NO6S/c1-11-10-15(28-29(25,26)18(19,20)21)12(2)16(23)22(11)9-8-13-4-6-14(7-5-13)17(24)27-3/h4-7,10H,8-9H2,1-3H3.
What are the key properties of methyl 4-[2-[3,6-dimethyl-2-oxo-4-(trifluoromethylsulfonyloxy)-1-pyridinyl]ethyl]benzoate?
methyl 4-[2-[3,6-dimethyl-2-oxo-4-(trifluoromethylsulfonyloxy)-1-pyridinyl]ethyl]benzoate has a molecular weight of 433.40 g/mol, XLogP of 2.72, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[2-[3,6-dimethyl-2-oxo-4-(trifluoromethylsulfonyloxy)-1-pyridinyl]ethyl]benzoate is sourced from PubChem (CID 58216099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).