About [(3R,4S)-3-methyloxan-4-yl]hydrazine
[(3R,4S)-3-methyloxan-4-yl]hydrazine (PubChem CID 58216796) has the molecular formula C6H14N2O
and a molecular weight of 130.19 g/mol. Its IUPAC name is [(3R,4S)-3-methyloxan-4-yl]hydrazine.
Molecular Properties
| Compound Name | [(3R,4S)-3-methyloxan-4-yl]hydrazine |
| PubChem CID | 58216796 |
| Molecular Formula | C6H14N2O |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.11 |
| IUPAC Name | [(3R,4S)-3-methyloxan-4-yl]hydrazine |
| SMILES | C[C@H]1COCC[C@@H]1NN |
| InChI | InChI=1S/C6H14N2O/c1-5-4-9-3-2-6(5)8-7/h5-6,8H,2-4,7H2,1H3/t5-,6-/m0/s1 |
| InChIKey | KKFDPUCSIBFAJS-WDSKDSINSA-N |
| XLogP | -0.13 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(3R,4S)-3-methyloxan-4-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4S)-3-methyloxan-4-yl]hydrazine?
The IUPAC name of [(3R,4S)-3-methyloxan-4-yl]hydrazine (CID 58216796) is [(3R,4S)-3-methyloxan-4-yl]hydrazine.
What is the SMILES notation for [(3R,4S)-3-methyloxan-4-yl]hydrazine?
The canonical SMILES for [(3R,4S)-3-methyloxan-4-yl]hydrazine is C[C@H]1COCC[C@@H]1NN.
What is the InChIKey of [(3R,4S)-3-methyloxan-4-yl]hydrazine?
The InChIKey is KKFDPUCSIBFAJS-WDSKDSINSA-N. The full InChI is InChI=1S/C6H14N2O/c1-5-4-9-3-2-6(5)8-7/h5-6,8H,2-4,7H2,1H3/t5-,6-/m0/s1.
What are the key properties of [(3R,4S)-3-methyloxan-4-yl]hydrazine?
[(3R,4S)-3-methyloxan-4-yl]hydrazine has a molecular weight of 130.19 g/mol, XLogP of -0.13, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4S)-3-methyloxan-4-yl]hydrazine is sourced from PubChem (CID 58216796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).