C33H36N4O2S — CID 58217221
methyl 1-cyclooctyl-2-[2-(3-phenylpropylamino)-1,3-benzothiazol-7-yl]benzimidazole-5-carboxylate (PubChem CID 58217221) has the molecular formula C33H36N4O2S and a molecular weight of 552.74 g/mol. Its IUPAC name is methyl 1-cyclooctyl-2-[2-(3-phenylpropylamino)-1,3-benzothiazol-7-yl]benzimidazole-5-carboxylate.
| Compound Name | methyl 1-cyclooctyl-2-[2-(3-phenylpropylamino)-1,3-benzothiazol-7-yl]benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 58217221 |
| Molecular Formula | C33H36N4O2S |
| Molecular Weight | 552.74 g/mol |
| Exact Mass | 552.26 |
| IUPAC Name | methyl 1-cyclooctyl-2-[2-(3-phenylpropylamino)-1,3-benzothiazol-7-yl]benzimidazole-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)nc(-c1cccc3nc(NCCCc4ccccc4)sc13)n2C1CCCCCCC1 |
| InChI | InChI=1S/C33H36N4O2S/c1-39-32(38)24-19-20-29-28(22-24)35-31(37(29)25-15-8-3-2-4-9-16-25)26-17-10-18-27-30(26)40-33(36-27)34-21-11-14-23-12-6-5-7-13-23/h5-7,10,12-13,17-20,22,25H,2-4,8-9,11,14-16,21H2,1H3,(H,34,36) |
| InChIKey | WVYXLTBXPMKHPV-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.74 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|