C40H36N4O2S — CID 58217226
methyl 1-(3,3-diphenylpropyl)-2-[2-(3-phenylpropylamino)-1,3-benzothiazol-7-yl]benzimidazole-5-carboxylate (PubChem CID 58217226) has the molecular formula C40H36N4O2S and a molecular weight of 636.82 g/mol. Its IUPAC name is methyl 1-(3,3-diphenylpropyl)-2-[2-(3-phenylpropylamino)-1,3-benzothiazol-7-yl]benzimidazole-5-carboxylate.
| Compound Name | methyl 1-(3,3-diphenylpropyl)-2-[2-(3-phenylpropylamino)-1,3-benzothiazol-7-yl]benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 58217226 |
| Molecular Formula | C40H36N4O2S |
| Molecular Weight | 636.82 g/mol |
| Exact Mass | 636.26 |
| IUPAC Name | methyl 1-(3,3-diphenylpropyl)-2-[2-(3-phenylpropylamino)-1,3-benzothiazol-7-yl]benzimidazole-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)nc(-c1cccc3nc(NCCCc4ccccc4)sc13)n2CCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H36N4O2S/c1-46-39(45)31-22-23-36-35(27-31)42-38(44(36)26-24-32(29-16-7-3-8-17-29)30-18-9-4-10-19-30)33-20-11-21-34-37(33)47-40(43-34)41-25-12-15-28-13-5-2-6-14-28/h2-11,13-14,16-23,27,32H,12,15,24-26H2,1H3,(H,41,43) |
| InChIKey | WARKXVPFBZWSRF-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.82 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|