C28H32N4O3S — CID 58217247
methyl 1-cyclooctyl-2-[2-(2-ethenoxyethylamino)-1,3-benzothiazol-7-yl]benzimidazole-5-carboxylate (PubChem CID 58217247) has the molecular formula C28H32N4O3S and a molecular weight of 504.66 g/mol. Its IUPAC name is methyl 1-cyclooctyl-2-[2-(2-ethenoxyethylamino)-1,3-benzothiazol-7-yl]benzimidazole-5-carboxylate.
| Compound Name | methyl 1-cyclooctyl-2-[2-(2-ethenoxyethylamino)-1,3-benzothiazol-7-yl]benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 58217247 |
| Molecular Formula | C28H32N4O3S |
| Molecular Weight | 504.66 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | methyl 1-cyclooctyl-2-[2-(2-ethenoxyethylamino)-1,3-benzothiazol-7-yl]benzimidazole-5-carboxylate |
| SMILES | C=COCCNc1nc2cccc(-c3nc4cc(C(=O)OC)ccc4n3C3CCCCCCC3)c2s1 |
| InChI | InChI=1S/C28H32N4O3S/c1-3-35-17-16-29-28-31-22-13-9-12-21(25(22)36-28)26-30-23-18-19(27(33)34-2)14-15-24(23)32(26)20-10-7-5-4-6-8-11-20/h3,9,12-15,18,20H,1,4-8,10-11,16-17H2,2H3,(H,29,31) |
| InChIKey | RVACAILETOPJTE-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.66 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|