About methyl 2-[2-(benzylamino)-1,3-benzothiazol-7-yl]-1-cyclooctylbenzimidazole-5-carboxylate
methyl 2-[2-(benzylamino)-1,3-benzothiazol-7-yl]-1-cyclooctylbenzimidazole-5-carboxylate (PubChem CID 58217258) has the molecular formula C31H32N4O2S
and a molecular weight of 524.69 g/mol. Its IUPAC name is methyl 2-[2-(benzylamino)-1,3-benzothiazol-7-yl]-1-cyclooctylbenzimidazole-5-carboxylate.
Molecular Properties
| Compound Name | methyl 2-[2-(benzylamino)-1,3-benzothiazol-7-yl]-1-cyclooctylbenzimidazole-5-carboxylate |
| PubChem CID | 58217258 |
| Molecular Formula | C31H32N4O2S |
| Molecular Weight | 524.69 g/mol |
| Exact Mass | 524.22 |
| IUPAC Name | methyl 2-[2-(benzylamino)-1,3-benzothiazol-7-yl]-1-cyclooctylbenzimidazole-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)nc(-c1cccc3nc(NCc4ccccc4)sc13)n2C1CCCCCCC1 |
| InChI | InChI=1S/C31H32N4O2S/c1-37-30(36)22-17-18-27-26(19-22)33-29(35(27)23-13-8-3-2-4-9-14-23)24-15-10-16-25-28(24)38-31(34-25)32-20-21-11-6-5-7-12-21/h5-7,10-12,15-19,23H,2-4,8-9,13-14,20H2,1H3,(H,32,34) |
| InChIKey | LTVLXWCSQUMYDY-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 524.69 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 2-[2-(benzylamino)-1,3-benzothiazol-7-yl]-1-cyclooctylbenzimidazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[2-(benzylamino)-1,3-benzothiazol-7-yl]-1-cyclooctylbenzimidazole-5-carboxylate?
The IUPAC name of methyl 2-[2-(benzylamino)-1,3-benzothiazol-7-yl]-1-cyclooctylbenzimidazole-5-carboxylate (CID 58217258) is methyl 2-[2-(benzylamino)-1,3-benzothiazol-7-yl]-1-cyclooctylbenzimidazole-5-carboxylate.
What is the SMILES notation for methyl 2-[2-(benzylamino)-1,3-benzothiazol-7-yl]-1-cyclooctylbenzimidazole-5-carboxylate?
The canonical SMILES for methyl 2-[2-(benzylamino)-1,3-benzothiazol-7-yl]-1-cyclooctylbenzimidazole-5-carboxylate is COC(=O)c1ccc2c(c1)nc(-c1cccc3nc(NCc4ccccc4)sc13)n2C1CCCCCCC1.
What is the InChIKey of methyl 2-[2-(benzylamino)-1,3-benzothiazol-7-yl]-1-cyclooctylbenzimidazole-5-carboxylate?
The InChIKey is LTVLXWCSQUMYDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H32N4O2S/c1-37-30(36)22-17-18-27-26(19-22)33-29(35(27)23-13-8-3-2-4-9-14-23)24-15-10-16-25-28(24)38-31(34-25)32-20-21-11-6-5-7-12-21/h5-7,10-12,15-19,23H,2-4,8-9,13-14,20H2,1H3,(H,32,34).
What are the key properties of methyl 2-[2-(benzylamino)-1,3-benzothiazol-7-yl]-1-cyclooctylbenzimidazole-5-carboxylate?
methyl 2-[2-(benzylamino)-1,3-benzothiazol-7-yl]-1-cyclooctylbenzimidazole-5-carboxylate has a molecular weight of 524.69 g/mol, XLogP of 8.00, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-(benzylamino)-1,3-benzothiazol-7-yl]-1-cyclooctylbenzimidazole-5-carboxylate is sourced from PubChem (CID 58217258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).