About methyl 2-[2-(butylamino)-1,3-benzothiazol-7-yl]-1-pentylbenzimidazole-5-carboxylate
methyl 2-[2-(butylamino)-1,3-benzothiazol-7-yl]-1-pentylbenzimidazole-5-carboxylate (PubChem CID 58217288) has the molecular formula C25H30N4O2S
and a molecular weight of 450.61 g/mol. Its IUPAC name is methyl 2-[2-(butylamino)-1,3-benzothiazol-7-yl]-1-pentylbenzimidazole-5-carboxylate.
Molecular Properties
| Compound Name | methyl 2-[2-(butylamino)-1,3-benzothiazol-7-yl]-1-pentylbenzimidazole-5-carboxylate |
| PubChem CID | 58217288 |
| Molecular Formula | C25H30N4O2S |
| Molecular Weight | 450.61 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | methyl 2-[2-(butylamino)-1,3-benzothiazol-7-yl]-1-pentylbenzimidazole-5-carboxylate |
| SMILES | CCCCCn1c(-c2cccc3nc(NCCCC)sc23)nc2cc(C(=O)OC)ccc21 |
| InChI | InChI=1S/C25H30N4O2S/c1-4-6-8-15-29-21-13-12-17(24(30)31-3)16-20(21)27-23(29)18-10-9-11-19-22(18)32-25(28-19)26-14-7-5-2/h9-13,16H,4-8,14-15H2,1-3H3,(H,26,28) |
| InChIKey | VIDSVZTWHFMUKA-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.61 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[2-(butylamino)-1,3-benzothiazol-7-yl]-1-pentylbenzimidazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[2-(butylamino)-1,3-benzothiazol-7-yl]-1-pentylbenzimidazole-5-carboxylate?
The IUPAC name of methyl 2-[2-(butylamino)-1,3-benzothiazol-7-yl]-1-pentylbenzimidazole-5-carboxylate (CID 58217288) is methyl 2-[2-(butylamino)-1,3-benzothiazol-7-yl]-1-pentylbenzimidazole-5-carboxylate.
What is the SMILES notation for methyl 2-[2-(butylamino)-1,3-benzothiazol-7-yl]-1-pentylbenzimidazole-5-carboxylate?
The canonical SMILES for methyl 2-[2-(butylamino)-1,3-benzothiazol-7-yl]-1-pentylbenzimidazole-5-carboxylate is CCCCCn1c(-c2cccc3nc(NCCCC)sc23)nc2cc(C(=O)OC)ccc21.
What is the InChIKey of methyl 2-[2-(butylamino)-1,3-benzothiazol-7-yl]-1-pentylbenzimidazole-5-carboxylate?
The InChIKey is VIDSVZTWHFMUKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H30N4O2S/c1-4-6-8-15-29-21-13-12-17(24(30)31-3)16-20(21)27-23(29)18-10-9-11-19-22(18)32-25(28-19)26-14-7-5-2/h9-13,16H,4-8,14-15H2,1-3H3,(H,26,28).
What are the key properties of methyl 2-[2-(butylamino)-1,3-benzothiazol-7-yl]-1-pentylbenzimidazole-5-carboxylate?
methyl 2-[2-(butylamino)-1,3-benzothiazol-7-yl]-1-pentylbenzimidazole-5-carboxylate has a molecular weight of 450.61 g/mol, XLogP of 6.50, 10 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-(butylamino)-1,3-benzothiazol-7-yl]-1-pentylbenzimidazole-5-carboxylate is sourced from PubChem (CID 58217288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).