About N-[[4-(1,3-benzoxazol-2-yl)-1-methylbenzimidazol-2-yl]methyl]-1,3-oxazol-2-amine
N-[[4-(1,3-benzoxazol-2-yl)-1-methylbenzimidazol-2-yl]methyl]-1,3-oxazol-2-amine (PubChem CID 58217338) has the molecular formula C19H15N5O2
and a molecular weight of 345.36 g/mol. Its IUPAC name is N-[[4-(1,3-benzoxazol-2-yl)-1-methylbenzimidazol-2-yl]methyl]-1,3-oxazol-2-amine.
Molecular Properties
| Compound Name | N-[[4-(1,3-benzoxazol-2-yl)-1-methylbenzimidazol-2-yl]methyl]-1,3-oxazol-2-amine |
| PubChem CID | 58217338 |
| Molecular Formula | C19H15N5O2 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | N-[[4-(1,3-benzoxazol-2-yl)-1-methylbenzimidazol-2-yl]methyl]-1,3-oxazol-2-amine |
| SMILES | Cn1c(CNc2ncco2)nc2c(-c3nc4ccccc4o3)cccc21 |
| InChI | InChI=1S/C19H15N5O2/c1-24-14-7-4-5-12(18-22-13-6-2-3-8-15(13)26-18)17(14)23-16(24)11-21-19-20-9-10-25-19/h2-10H,11H2,1H3,(H,20,21) |
| InChIKey | GUZRSRSIZRTBAP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[[4-(1,3-benzoxazol-2-yl)-1-methylbenzimidazol-2-yl]methyl]-1,3-oxazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-(1,3-benzoxazol-2-yl)-1-methylbenzimidazol-2-yl]methyl]-1,3-oxazol-2-amine?
The IUPAC name of N-[[4-(1,3-benzoxazol-2-yl)-1-methylbenzimidazol-2-yl]methyl]-1,3-oxazol-2-amine (CID 58217338) is N-[[4-(1,3-benzoxazol-2-yl)-1-methylbenzimidazol-2-yl]methyl]-1,3-oxazol-2-amine.
What is the SMILES notation for N-[[4-(1,3-benzoxazol-2-yl)-1-methylbenzimidazol-2-yl]methyl]-1,3-oxazol-2-amine?
The canonical SMILES for N-[[4-(1,3-benzoxazol-2-yl)-1-methylbenzimidazol-2-yl]methyl]-1,3-oxazol-2-amine is Cn1c(CNc2ncco2)nc2c(-c3nc4ccccc4o3)cccc21.
What is the InChIKey of N-[[4-(1,3-benzoxazol-2-yl)-1-methylbenzimidazol-2-yl]methyl]-1,3-oxazol-2-amine?
The InChIKey is GUZRSRSIZRTBAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15N5O2/c1-24-14-7-4-5-12(18-22-13-6-2-3-8-15(13)26-18)17(14)23-16(24)11-21-19-20-9-10-25-19/h2-10H,11H2,1H3,(H,20,21).
What are the key properties of N-[[4-(1,3-benzoxazol-2-yl)-1-methylbenzimidazol-2-yl]methyl]-1,3-oxazol-2-amine?
N-[[4-(1,3-benzoxazol-2-yl)-1-methylbenzimidazol-2-yl]methyl]-1,3-oxazol-2-amine has a molecular weight of 345.36 g/mol, XLogP of 3.98, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-(1,3-benzoxazol-2-yl)-1-methylbenzimidazol-2-yl]methyl]-1,3-oxazol-2-amine is sourced from PubChem (CID 58217338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).