C35H34N4O3S — CID 58217372
methyl 1-(3,3-diphenylpropyl)-2-[2-(3-methoxypropylamino)-1,3-benzothiazol-7-yl]benzimidazole-5-carboxylate (PubChem CID 58217372) has the molecular formula C35H34N4O3S and a molecular weight of 590.75 g/mol. Its IUPAC name is methyl 1-(3,3-diphenylpropyl)-2-[2-(3-methoxypropylamino)-1,3-benzothiazol-7-yl]benzimidazole-5-carboxylate.
| Compound Name | methyl 1-(3,3-diphenylpropyl)-2-[2-(3-methoxypropylamino)-1,3-benzothiazol-7-yl]benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 58217372 |
| Molecular Formula | C35H34N4O3S |
| Molecular Weight | 590.75 g/mol |
| Exact Mass | 590.24 |
| IUPAC Name | methyl 1-(3,3-diphenylpropyl)-2-[2-(3-methoxypropylamino)-1,3-benzothiazol-7-yl]benzimidazole-5-carboxylate |
| SMILES | COCCCNc1nc2cccc(-c3nc4cc(C(=O)OC)ccc4n3CCC(c3ccccc3)c3ccccc3)c2s1 |
| InChI | InChI=1S/C35H34N4O3S/c1-41-22-10-20-36-35-38-29-16-9-15-28(32(29)43-35)33-37-30-23-26(34(40)42-2)17-18-31(30)39(33)21-19-27(24-11-5-3-6-12-24)25-13-7-4-8-14-25/h3-9,11-18,23,27H,10,19-22H2,1-2H3,(H,36,38) |
| InChIKey | HIZFWLIVMWJNHD-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.75 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|