C20H23BrN6O4S — CID 58217658
5-(4-bromo-2,3,5,6-tetradeuteriophenyl)-6-[2,2-dideuterio-2-(5-methylpyrimidin-2-yl)oxyethoxy]-N-(1,1,2,2-tetradeuteriopropylsulfamoyl)pyrimidin-4-amine (PubChem CID 58217658) has the molecular formula C20H23BrN6O4S and a molecular weight of 533.47 g/mol. Its IUPAC name is 5-(4-bromo-2,3,5,6-tetradeuteriophenyl)-6-[2,2-dideuterio-2-(5-methylpyrimidin-2-yl)oxyethoxy]-N-(1,1,2,2-tetradeuteriopropylsulfamoyl)pyrimidin-4-amine.
| Compound Name | 5-(4-bromo-2,3,5,6-tetradeuteriophenyl)-6-[2,2-dideuterio-2-(5-methylpyrimidin-2-yl)oxyethoxy]-N-(1,1,2,2-tetradeuteriopropylsulfamoyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 58217658 |
| Molecular Formula | C20H23BrN6O4S |
| Molecular Weight | 533.47 g/mol |
| Exact Mass | 532.13 |
| IUPAC Name | 5-(4-bromo-2,3,5,6-tetradeuteriophenyl)-6-[2,2-dideuterio-2-(5-methylpyrimidin-2-yl)oxyethoxy]-N-(1,1,2,2-tetradeuteriopropylsulfamoyl)pyrimidin-4-amine |
| SMILES | [2H]c1c([2H])c(-c2c(NS(=O)(=O)NC([2H])([2H])C([2H])([2H])C)ncnc2OCC([2H])([2H])Oc2ncc(C)cn2)c([2H])c([2H])c1Br |
| InChI | InChI=1S/C20H23BrN6O4S/c1-3-8-26-32(28,29)27-18-17(15-4-6-16(21)7-5-15)19(25-13-24-18)30-9-10-31-20-22-11-14(2)12-23-20/h4-7,11-13,26H,3,8-10H2,1-2H3,(H,24,25,27)/i3D2,4D,5D,6D,7D,8D2,10D2 |
| InChIKey | KEQJUEFSNTZSBB-REERGVLUSA-N |
| XLogP | 3.12 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |