C17H21ClN2O4S — CID 58218115
1-[5-(2-chlorophenyl)sulfonyl-4,4-dimethylpentyl]pyrimidine-2,4-dione (PubChem CID 58218115) has the molecular formula C17H21ClN2O4S and a molecular weight of 384.89 g/mol. Its IUPAC name is 1-[5-(2-chlorophenyl)sulfonyl-4,4-dimethylpentyl]pyrimidine-2,4-dione.
| Compound Name | 1-[5-(2-chlorophenyl)sulfonyl-4,4-dimethylpentyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 58218115 |
| Molecular Formula | C17H21ClN2O4S |
| Molecular Weight | 384.89 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 1-[5-(2-chlorophenyl)sulfonyl-4,4-dimethylpentyl]pyrimidine-2,4-dione |
| SMILES | CC(C)(CCCn1ccc(=O)[nH]c1=O)CS(=O)(=O)c1ccccc1Cl |
| InChI | InChI=1S/C17H21ClN2O4S/c1-17(2,9-5-10-20-11-8-15(21)19-16(20)22)12-25(23,24)14-7-4-3-6-13(14)18/h3-4,6-8,11H,5,9-10,12H2,1-2H3,(H,19,21,22) |
| InChIKey | NXCSELFYCNYHQE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 89.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.89 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |