C10H13F2NO — CID 58218153
[3-(1,3-difluoropropan-2-yloxy)phenyl]methanamine (PubChem CID 58218153) has the molecular formula C10H13F2NO and a molecular weight of 201.22 g/mol. Its IUPAC name is [3-(1,3-difluoropropan-2-yloxy)phenyl]methanamine.
| Compound Name | [3-(1,3-difluoropropan-2-yloxy)phenyl]methanamine |
|---|---|
| PubChem CID | 58218153 |
| Molecular Formula | C10H13F2NO |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | [3-(1,3-difluoropropan-2-yloxy)phenyl]methanamine |
| SMILES | NCc1cccc(OC(CF)CF)c1 |
| InChI | InChI=1S/C10H13F2NO/c11-5-10(6-12)14-9-3-1-2-8(4-9)7-13/h1-4,10H,5-7,13H2 |
| InChIKey | JLKYZWQQISDEJE-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |