C17H20O3S — CID 58218199
3-(2,2-diphenylethylsulfonyl)propan-1-ol (PubChem CID 58218199) has the molecular formula C17H20O3S and a molecular weight of 304.41 g/mol. Its IUPAC name is 3-(2,2-diphenylethylsulfonyl)propan-1-ol.
| Compound Name | 3-(2,2-diphenylethylsulfonyl)propan-1-ol |
|---|---|
| PubChem CID | 58218199 |
| Molecular Formula | C17H20O3S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 3-(2,2-diphenylethylsulfonyl)propan-1-ol |
| SMILES | O=S(=O)(CCCO)CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H20O3S/c18-12-7-13-21(19,20)14-17(15-8-3-1-4-9-15)16-10-5-2-6-11-16/h1-6,8-11,17-18H,7,12-14H2 |
| InChIKey | WPWBCJQZJDKWKT-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |