C20H26N2O5S2 — CID 58218315
1-[3-[2-[3-(cyclopropylmethylsulfanyl)phenyl]ethylsulfonyl]propoxymethyl]pyrimidine-2,4-dione (PubChem CID 58218315) has the molecular formula C20H26N2O5S2 and a molecular weight of 438.57 g/mol. Its IUPAC name is 1-[3-[2-[3-(cyclopropylmethylsulfanyl)phenyl]ethylsulfonyl]propoxymethyl]pyrimidine-2,4-dione.
| Compound Name | 1-[3-[2-[3-(cyclopropylmethylsulfanyl)phenyl]ethylsulfonyl]propoxymethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 58218315 |
| Molecular Formula | C20H26N2O5S2 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | 1-[3-[2-[3-(cyclopropylmethylsulfanyl)phenyl]ethylsulfonyl]propoxymethyl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn(COCCCS(=O)(=O)CCc2cccc(SCC3CC3)c2)c(=O)[nH]1 |
| InChI | InChI=1S/C20H26N2O5S2/c23-19-7-9-22(20(24)21-19)15-27-10-2-11-29(25,26)12-8-16-3-1-4-18(13-16)28-14-17-5-6-17/h1,3-4,7,9,13,17H,2,5-6,8,10-12,14-15H2,(H,21,23,24) |
| InChIKey | PRSRWVLQNWFHQO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|