C22H29FN2O5S — CID 58218423
1-[5-[(2R)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]propyl]sulfonylpentyl]pyrimidine-2,4-dione (PubChem CID 58218423) has the molecular formula C22H29FN2O5S and a molecular weight of 452.55 g/mol. Its IUPAC name is 1-[5-[(2R)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]propyl]sulfonylpentyl]pyrimidine-2,4-dione.
| Compound Name | 1-[5-[(2R)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]propyl]sulfonylpentyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 58218423 |
| Molecular Formula | C22H29FN2O5S |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | 1-[5-[(2R)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]propyl]sulfonylpentyl]pyrimidine-2,4-dione |
| SMILES | C[C@@H](CS(=O)(=O)CCCCCn1ccc(=O)[nH]c1=O)c1ccc(F)c(OCC2CC2)c1 |
| InChI | InChI=1S/C22H29FN2O5S/c1-16(18-7-8-19(23)20(13-18)30-14-17-5-6-17)15-31(28,29)12-4-2-3-10-25-11-9-21(26)24-22(25)27/h7-9,11,13,16-17H,2-6,10,12,14-15H2,1H3,(H,24,26,27)/t16-/m0/s1 |
| InChIKey | KJUBELOJPUDOED-INIZCTEOSA-N |
| XLogP | 2.85 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|