C19H26N2O5S — CID 58218472
1-[[4,4-dimethyl-5-(4-methylphenyl)sulfonylpentoxy]methyl]pyrimidine-2,4-dione (PubChem CID 58218472) has the molecular formula C19H26N2O5S and a molecular weight of 394.49 g/mol. Its IUPAC name is 1-[[4,4-dimethyl-5-(4-methylphenyl)sulfonylpentoxy]methyl]pyrimidine-2,4-dione.
| Compound Name | 1-[[4,4-dimethyl-5-(4-methylphenyl)sulfonylpentoxy]methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 58218472 |
| Molecular Formula | C19H26N2O5S |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 1-[[4,4-dimethyl-5-(4-methylphenyl)sulfonylpentoxy]methyl]pyrimidine-2,4-dione |
| SMILES | Cc1ccc(S(=O)(=O)CC(C)(C)CCCOCn2ccc(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C19H26N2O5S/c1-15-5-7-16(8-6-15)27(24,25)13-19(2,3)10-4-12-26-14-21-11-9-17(22)20-18(21)23/h5-9,11H,4,10,12-14H2,1-3H3,(H,20,22,23) |
| InChIKey | JHGRSNNJHHCTEG-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|