C21H28N2O5S — CID 58218496
1-[[4,4-dimethyl-5-[3-[(Z)-prop-1-enyl]phenyl]sulfonylpentoxy]methyl]pyrimidine-2,4-dione (PubChem CID 58218496) has the molecular formula C21H28N2O5S and a molecular weight of 420.53 g/mol. Its IUPAC name is 1-[[4,4-dimethyl-5-[3-[(Z)-prop-1-enyl]phenyl]sulfonylpentoxy]methyl]pyrimidine-2,4-dione.
| Compound Name | 1-[[4,4-dimethyl-5-[3-[(Z)-prop-1-enyl]phenyl]sulfonylpentoxy]methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 58218496 |
| Molecular Formula | C21H28N2O5S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 1-[[4,4-dimethyl-5-[3-[(Z)-prop-1-enyl]phenyl]sulfonylpentoxy]methyl]pyrimidine-2,4-dione |
| SMILES | C/C=C\c1cccc(S(=O)(=O)CC(C)(C)CCCOCn2ccc(=O)[nH]c2=O)c1 |
| InChI | InChI=1S/C21H28N2O5S/c1-4-7-17-8-5-9-18(14-17)29(26,27)15-21(2,3)11-6-13-28-16-23-12-10-19(24)22-20(23)25/h4-5,7-10,12,14H,6,11,13,15-16H2,1-3H3,(H,22,24,25)/b7-4- |
| InChIKey | XOMVVNXSBIEDJN-DAXSKMNVSA-N |
| XLogP | 2.82 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|