C17H19NO5 — CID 58218850
methyl 2-(2,6-dimethylphenyl)-1,7-dioxo-4,7a-dihydro-3H-pyrano[3,4-c]pyrrole-3a-carboxylate (PubChem CID 58218850) has the molecular formula C17H19NO5 and a molecular weight of 317.34 g/mol. Its IUPAC name is methyl 2-(2,6-dimethylphenyl)-1,7-dioxo-4,7a-dihydro-3H-pyrano[3,4-c]pyrrole-3a-carboxylate.
| Compound Name | methyl 2-(2,6-dimethylphenyl)-1,7-dioxo-4,7a-dihydro-3H-pyrano[3,4-c]pyrrole-3a-carboxylate |
|---|---|
| PubChem CID | 58218850 |
| Molecular Formula | C17H19NO5 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | methyl 2-(2,6-dimethylphenyl)-1,7-dioxo-4,7a-dihydro-3H-pyrano[3,4-c]pyrrole-3a-carboxylate |
| SMILES | COC(=O)C12COCC(=O)C1C(=O)N(c1c(C)cccc1C)C2 |
| InChI | InChI=1S/C17H19NO5/c1-10-5-4-6-11(2)14(10)18-8-17(16(21)22-3)9-23-7-12(19)13(17)15(18)20/h4-6,13H,7-9H2,1-3H3 |
| InChIKey | OKZKREZABPRFIJ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|