About [4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]hydrazine
[4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]hydrazine (PubChem CID 58218885) has the molecular formula C17H16Cl2F3N3
and a molecular weight of 390.24 g/mol. Its IUPAC name is [4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]hydrazine.
Molecular Properties
| Compound Name | [4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]hydrazine |
| PubChem CID | 58218885 |
| Molecular Formula | C17H16Cl2F3N3 |
| Molecular Weight | 390.24 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | [4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]hydrazine |
| SMILES | NNc1ccc(N2CCC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C17H16Cl2F3N3/c18-12-7-11(8-13(19)9-12)16(17(20,21)22)5-6-25(10-16)15-3-1-14(24-23)2-4-15/h1-4,7-9,24H,5-6,10,23H2 |
| InChIKey | YZFHXJNWBGEJRG-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.24 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]hydrazine?
The IUPAC name of [4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]hydrazine (CID 58218885) is [4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]hydrazine.
What is the SMILES notation for [4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]hydrazine?
The canonical SMILES for [4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]hydrazine is NNc1ccc(N2CCC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)cc1.
What is the InChIKey of [4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]hydrazine?
The InChIKey is YZFHXJNWBGEJRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16Cl2F3N3/c18-12-7-11(8-13(19)9-12)16(17(20,21)22)5-6-25(10-16)15-3-1-14(24-23)2-4-15/h1-4,7-9,24H,5-6,10,23H2.
What are the key properties of [4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]hydrazine?
[4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]hydrazine has a molecular weight of 390.24 g/mol, XLogP of 4.99, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]phenyl]hydrazine is sourced from PubChem (CID 58218885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).