About 2-bromo-4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]aniline
2-bromo-4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]aniline (PubChem CID 58218890) has the molecular formula C17H14BrCl2F3N2
and a molecular weight of 454.12 g/mol. Its IUPAC name is 2-bromo-4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]aniline.
Molecular Properties
| Compound Name | 2-bromo-4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]aniline |
| PubChem CID | 58218890 |
| Molecular Formula | C17H14BrCl2F3N2 |
| Molecular Weight | 454.12 g/mol |
| Exact Mass | 451.97 |
| IUPAC Name | 2-bromo-4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]aniline |
| SMILES | Nc1ccc(N2CCC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)cc1Br |
| InChI | InChI=1S/C17H14BrCl2F3N2/c18-14-8-13(1-2-15(14)24)25-4-3-16(9-25,17(21,22)23)10-5-11(19)7-12(20)6-10/h1-2,5-8H,3-4,9,24H2 |
| InChIKey | NOMJGSOFDLDANS-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.12 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]aniline?
The IUPAC name of 2-bromo-4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]aniline (CID 58218890) is 2-bromo-4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]aniline.
What is the SMILES notation for 2-bromo-4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]aniline?
The canonical SMILES for 2-bromo-4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]aniline is Nc1ccc(N2CCC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)cc1Br.
What is the InChIKey of 2-bromo-4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]aniline?
The InChIKey is NOMJGSOFDLDANS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14BrCl2F3N2/c18-14-8-13(1-2-15(14)24)25-4-3-16(9-25,17(21,22)23)10-5-11(19)7-12(20)6-10/h1-2,5-8H,3-4,9,24H2.
What are the key properties of 2-bromo-4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]aniline?
2-bromo-4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]aniline has a molecular weight of 454.12 g/mol, XLogP of 6.05, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]aniline is sourced from PubChem (CID 58218890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).