C20H25NO7S2 — CID 58218984
5-[4-carboxy-4-[5-(dithiolan-3-yl)pentanoylamino]-2-oxobutyl]-2-hydroxybenzoic acid (PubChem CID 58218984) has the molecular formula C20H25NO7S2 and a molecular weight of 455.55 g/mol. Its IUPAC name is 5-[4-carboxy-4-[5-(dithiolan-3-yl)pentanoylamino]-2-oxobutyl]-2-hydroxybenzoic acid.
| Compound Name | 5-[4-carboxy-4-[5-(dithiolan-3-yl)pentanoylamino]-2-oxobutyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 58218984 |
| Molecular Formula | C20H25NO7S2 |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 5-[4-carboxy-4-[5-(dithiolan-3-yl)pentanoylamino]-2-oxobutyl]-2-hydroxybenzoic acid |
| SMILES | O=C(Cc1ccc(O)c(C(=O)O)c1)CC(NC(=O)CCCCC1CCSS1)C(=O)O |
| InChI | InChI=1S/C20H25NO7S2/c22-13(9-12-5-6-17(23)15(10-12)19(25)26)11-16(20(27)28)21-18(24)4-2-1-3-14-7-8-29-30-14/h5-6,10,14,16,23H,1-4,7-9,11H2,(H,21,24)(H,25,26)(H,27,28) |
| InChIKey | WLFHWWDIPQRQPH-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 141.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|