C29H34N2O8S — CID 58219005
methyl 3-[2,5-dioxo-1-[(Z)-4-oxonon-6-enyl]pyrrolidin-3-yl]sulfanyl-2-[(5-methyl-4-oxo-5-phenylfuran-2-carbonyl)amino]propanoate (PubChem CID 58219005) has the molecular formula C29H34N2O8S and a molecular weight of 570.66 g/mol. Its IUPAC name is methyl 3-[2,5-dioxo-1-[(Z)-4-oxonon-6-enyl]pyrrolidin-3-yl]sulfanyl-2-[(5-methyl-4-oxo-5-phenylfuran-2-carbonyl)amino]propanoate.
| Compound Name | methyl 3-[2,5-dioxo-1-[(Z)-4-oxonon-6-enyl]pyrrolidin-3-yl]sulfanyl-2-[(5-methyl-4-oxo-5-phenylfuran-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 58219005 |
| Molecular Formula | C29H34N2O8S |
| Molecular Weight | 570.66 g/mol |
| Exact Mass | 570.20 |
| IUPAC Name | methyl 3-[2,5-dioxo-1-[(Z)-4-oxonon-6-enyl]pyrrolidin-3-yl]sulfanyl-2-[(5-methyl-4-oxo-5-phenylfuran-2-carbonyl)amino]propanoate |
| SMILES | CC/C=C\CC(=O)CCCN1C(=O)CC(SCC(NC(=O)C2=CC(=O)C(C)(c3ccccc3)O2)C(=O)OC)C1=O |
| InChI | InChI=1S/C29H34N2O8S/c1-4-5-7-13-20(32)14-10-15-31-25(34)17-23(27(31)36)40-18-21(28(37)38-3)30-26(35)22-16-24(33)29(2,39-22)19-11-8-6-9-12-19/h5-9,11-12,16,21,23H,4,10,13-15,17-18H2,1-3H3,(H,30,35)/b7-5- |
| InChIKey | QWSUBIACQSHEDJ-ALCCZGGFSA-N |
| XLogP | 2.61 |
| TPSA | 136.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.66 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|