C23H32O2S — CID 58219190
[4-(5-methyl-3-octylthiophen-2-yl)phenyl] 2-methylpropanoate (PubChem CID 58219190) has the molecular formula C23H32O2S and a molecular weight of 372.57 g/mol. Its IUPAC name is [4-(5-methyl-3-octylthiophen-2-yl)phenyl] 2-methylpropanoate.
| Compound Name | [4-(5-methyl-3-octylthiophen-2-yl)phenyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 58219190 |
| Molecular Formula | C23H32O2S |
| Molecular Weight | 372.57 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | [4-(5-methyl-3-octylthiophen-2-yl)phenyl] 2-methylpropanoate |
| SMILES | CCCCCCCCc1cc(C)sc1-c1ccc(OC(=O)C(C)C)cc1 |
| InChI | InChI=1S/C23H32O2S/c1-5-6-7-8-9-10-11-20-16-18(4)26-22(20)19-12-14-21(15-13-19)25-23(24)17(2)3/h12-17H,5-11H2,1-4H3 |
| InChIKey | WBAMWFUPQSSANA-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.57 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|