C23H38O10 — CID 58219257
2-methoxyethyl 3-[(4R)-4-[(4S,5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(3-oxobutyl)-1,3-dioxolan-2-yl]propanoate (PubChem CID 58219257) has the molecular formula C23H38O10 and a molecular weight of 474.55 g/mol. Its IUPAC name is 2-methoxyethyl 3-[(4R)-4-[(4S,5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(3-oxobutyl)-1,3-dioxolan-2-yl]propanoate.
| Compound Name | 2-methoxyethyl 3-[(4R)-4-[(4S,5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(3-oxobutyl)-1,3-dioxolan-2-yl]propanoate |
|---|---|
| PubChem CID | 58219257 |
| Molecular Formula | C23H38O10 |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | 2-methoxyethyl 3-[(4R)-4-[(4S,5R)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(3-oxobutyl)-1,3-dioxolan-2-yl]propanoate |
| SMILES | COCCOC(=O)CCC1(CCC(C)=O)OC[C@H]([C@@H]2OC(C)(C)O[C@@H]2[C@@H]2COC(C)(C)O2)O1 |
| InChI | InChI=1S/C23H38O10/c1-15(24)7-9-23(10-8-18(25)27-12-11-26-6)29-14-17(31-23)20-19(32-22(4,5)33-20)16-13-28-21(2,3)30-16/h16-17,19-20H,7-14H2,1-6H3/t16-,17+,19+,20-,23?/m0/s1 |
| InChIKey | BPOPPBSLUYBSTL-DOCSTXALSA-N |
| XLogP | 2.11 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|