About 8-penta-2,4-dienylnaphthalen-1-amine
8-penta-2,4-dienylnaphthalen-1-amine (PubChem CID 58219729) has the molecular formula C15H15N
and a molecular weight of 209.29 g/mol. Its IUPAC name is 8-penta-2,4-dienylnaphthalen-1-amine.
Molecular Properties
| Compound Name | 8-penta-2,4-dienylnaphthalen-1-amine |
| PubChem CID | 58219729 |
| Molecular Formula | C15H15N |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 8-penta-2,4-dienylnaphthalen-1-amine |
| SMILES | C=CC=CCc1cccc2cccc(N)c12 |
| InChI | InChI=1S/C15H15N/c1-2-3-4-7-12-8-5-9-13-10-6-11-14(16)15(12)13/h2-6,8-11H,1,7,16H2 |
| InChIKey | VIXQQMJOKQKBLU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 8-penta-2,4-dienylnaphthalen-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-penta-2,4-dienylnaphthalen-1-amine?
The IUPAC name of 8-penta-2,4-dienylnaphthalen-1-amine (CID 58219729) is 8-penta-2,4-dienylnaphthalen-1-amine.
What is the SMILES notation for 8-penta-2,4-dienylnaphthalen-1-amine?
The canonical SMILES for 8-penta-2,4-dienylnaphthalen-1-amine is C=CC=CCc1cccc2cccc(N)c12.
What is the InChIKey of 8-penta-2,4-dienylnaphthalen-1-amine?
The InChIKey is VIXQQMJOKQKBLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N/c1-2-3-4-7-12-8-5-9-13-10-6-11-14(16)15(12)13/h2-6,8-11H,1,7,16H2.
What are the key properties of 8-penta-2,4-dienylnaphthalen-1-amine?
8-penta-2,4-dienylnaphthalen-1-amine has a molecular weight of 209.29 g/mol, XLogP of 3.71, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-penta-2,4-dienylnaphthalen-1-amine is sourced from PubChem (CID 58219729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).