C7H12F3ORf- — CID 58219982
4-ethoxy-1,1,1-trifluoro-2-methanidylbutane;rutherfordium (PubChem CID 58219982) has the molecular formula C7H12F3ORf- and a molecular weight of 436.17 g/mol. Its IUPAC name is 4-ethoxy-1,1,1-trifluoro-2-methanidylbutane;rutherfordium.
| Compound Name | 4-ethoxy-1,1,1-trifluoro-2-methanidylbutane;rutherfordium |
|---|---|
| PubChem CID | 58219982 |
| Molecular Formula | C7H12F3ORf- |
| Molecular Weight | 436.17 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 4-ethoxy-1,1,1-trifluoro-2-methanidylbutane;rutherfordium |
| SMILES | [CH2-]C(CCOCC)C(F)(F)F.[Rf] |
| InChI | InChI=1S/C7H12F3O.Rf/c1-3-11-5-4-6(2)7(8,9)10;/h6H,2-5H2,1H3;/q-1; |
| InChIKey | GDXHTZGRKWXMBB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.17 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|