C20H20ClN3O2 — CID 58220652
methyl 5-chloro-2-cyclopropyl-6-[2-(3H-inden-1-yl)ethylamino]pyrimidine-4-carboxylate (PubChem CID 58220652) has the molecular formula C20H20ClN3O2 and a molecular weight of 369.85 g/mol. Its IUPAC name is methyl 5-chloro-2-cyclopropyl-6-[2-(3H-inden-1-yl)ethylamino]pyrimidine-4-carboxylate.
| Compound Name | methyl 5-chloro-2-cyclopropyl-6-[2-(3H-inden-1-yl)ethylamino]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 58220652 |
| Molecular Formula | C20H20ClN3O2 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | methyl 5-chloro-2-cyclopropyl-6-[2-(3H-inden-1-yl)ethylamino]pyrimidine-4-carboxylate |
| SMILES | COC(=O)c1nc(C2CC2)nc(NCCC2=CCc3ccccc32)c1Cl |
| InChI | InChI=1S/C20H20ClN3O2/c1-26-20(25)17-16(21)19(24-18(23-17)14-8-9-14)22-11-10-13-7-6-12-4-2-3-5-15(12)13/h2-5,7,14H,6,8-11H2,1H3,(H,22,23,24) |
| InChIKey | UNJOWVHSNOCMBL-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |