C17H13ClFN3O3 — CID 58220812
methyl 5-chloro-2-(4-fluorophenyl)-6-(furan-2-ylmethylamino)pyrimidine-4-carboxylate (PubChem CID 58220812) has the molecular formula C17H13ClFN3O3 and a molecular weight of 361.76 g/mol. Its IUPAC name is methyl 5-chloro-2-(4-fluorophenyl)-6-(furan-2-ylmethylamino)pyrimidine-4-carboxylate.
| Compound Name | methyl 5-chloro-2-(4-fluorophenyl)-6-(furan-2-ylmethylamino)pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 58220812 |
| Molecular Formula | C17H13ClFN3O3 |
| Molecular Weight | 361.76 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | methyl 5-chloro-2-(4-fluorophenyl)-6-(furan-2-ylmethylamino)pyrimidine-4-carboxylate |
| SMILES | COC(=O)c1nc(-c2ccc(F)cc2)nc(NCc2ccco2)c1Cl |
| InChI | InChI=1S/C17H13ClFN3O3/c1-24-17(23)14-13(18)16(20-9-12-3-2-8-25-12)22-15(21-14)10-4-6-11(19)7-5-10/h2-8H,9H2,1H3,(H,20,21,22) |
| InChIKey | XSURVLBRGMIDIS-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.76 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |