About cis-ethyl (1S,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclopentane-1-carboxylate
cis-ethyl (1S,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclopentane-1-carboxylate (PubChem CID 58221011) has the molecular formula C14H28O3Si
and a molecular weight of 272.46 g/mol. Its IUPAC name is cis-ethyl (1S,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclopentane-1-carboxylate.
Molecular Properties
| Compound Name | cis-ethyl (1S,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclopentane-1-carboxylate |
| PubChem CID | 58221011 |
| Molecular Formula | C14H28O3Si |
| Molecular Weight | 272.46 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | cis-ethyl (1S,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclopentane-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCC[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H28O3Si/c1-7-16-13(15)11-9-8-10-12(11)17-18(5,6)14(2,3)4/h11-12H,7-10H2,1-6H3/t11-,12+/m0/s1 |
| InChIKey | FESLGQSAIKKHKS-NWDGAFQWSA-N |
| XLogP | 3.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cis-ethyl (1S,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-ethyl (1S,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclopentane-1-carboxylate?
The IUPAC name of cis-ethyl (1S,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclopentane-1-carboxylate (CID 58221011) is cis-ethyl (1S,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclopentane-1-carboxylate.
What is the SMILES notation for cis-ethyl (1S,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclopentane-1-carboxylate?
The canonical SMILES for cis-ethyl (1S,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclopentane-1-carboxylate is CCOC(=O)[C@H]1CCC[C@H]1O[Si](C)(C)C(C)(C)C.
What is the InChIKey of cis-ethyl (1S,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclopentane-1-carboxylate?
The InChIKey is FESLGQSAIKKHKS-NWDGAFQWSA-N. The full InChI is InChI=1S/C14H28O3Si/c1-7-16-13(15)11-9-8-10-12(11)17-18(5,6)14(2,3)4/h11-12H,7-10H2,1-6H3/t11-,12+/m0/s1.
What are the key properties of cis-ethyl (1S,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclopentane-1-carboxylate?
cis-ethyl (1S,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclopentane-1-carboxylate has a molecular weight of 272.46 g/mol, XLogP of 3.74, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-ethyl (1S,2R)-2-[tert-butyl(dimethyl)silyl]oxycyclopentane-1-carboxylate is sourced from PubChem (CID 58221011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).