About 3-ethyl-3-methanidyl-2,4-dimethylpentane;tungsten(2+)
3-ethyl-3-methanidyl-2,4-dimethylpentane;tungsten(2+) (PubChem CID 58221715) has the molecular formula C10H20W
and a molecular weight of 324.11 g/mol. Its IUPAC name is 3-ethyl-3-methanidyl-2,4-dimethylpentane;tungsten(2+).
Molecular Properties
| Compound Name | 3-ethyl-3-methanidyl-2,4-dimethylpentane;tungsten(2+) |
| PubChem CID | 58221715 |
| Molecular Formula | C10H20W |
| Molecular Weight | 324.11 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 3-ethyl-3-methanidyl-2,4-dimethylpentane;tungsten(2+) |
| SMILES | [CH2-]CC([CH2-])(C(C)C)C(C)C.[W+2] |
| InChI | InChI=1S/C10H20.W/c1-7-10(6,8(2)3)9(4)5;/h8-9H,1,6-7H2,2-5H3;/q-2;+2 |
| InChIKey | IXSVBXGXPNTBEW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.11 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-3-methanidyl-2,4-dimethylpentane;tungsten(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-3-methanidyl-2,4-dimethylpentane;tungsten(2+)?
The IUPAC name of 3-ethyl-3-methanidyl-2,4-dimethylpentane;tungsten(2+) (CID 58221715) is 3-ethyl-3-methanidyl-2,4-dimethylpentane;tungsten(2+).
What is the SMILES notation for 3-ethyl-3-methanidyl-2,4-dimethylpentane;tungsten(2+)?
The canonical SMILES for 3-ethyl-3-methanidyl-2,4-dimethylpentane;tungsten(2+) is [CH2-]CC([CH2-])(C(C)C)C(C)C.[W+2].
What is the InChIKey of 3-ethyl-3-methanidyl-2,4-dimethylpentane;tungsten(2+)?
The InChIKey is IXSVBXGXPNTBEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20.W/c1-7-10(6,8(2)3)9(4)5;/h8-9H,1,6-7H2,2-5H3;/q-2;+2.
What are the key properties of 3-ethyl-3-methanidyl-2,4-dimethylpentane;tungsten(2+)?
3-ethyl-3-methanidyl-2,4-dimethylpentane;tungsten(2+) has a molecular weight of 324.11 g/mol, XLogP of 3.34, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-3-methanidyl-2,4-dimethylpentane;tungsten(2+) is sourced from PubChem (CID 58221715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).