About (2R)-3-(2,4-dichlorophenyl)-2-(pyrrolidine-1-carbonylamino)propanoic acid
(2R)-3-(2,4-dichlorophenyl)-2-(pyrrolidine-1-carbonylamino)propanoic acid (PubChem CID 58221934) has the molecular formula C14H16Cl2N2O3
and a molecular weight of 331.20 g/mol. Its IUPAC name is (2R)-3-(2,4-dichlorophenyl)-2-(pyrrolidine-1-carbonylamino)propanoic acid.
Molecular Properties
| Compound Name | (2R)-3-(2,4-dichlorophenyl)-2-(pyrrolidine-1-carbonylamino)propanoic acid |
| PubChem CID | 58221934 |
| Molecular Formula | C14H16Cl2N2O3 |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | (2R)-3-(2,4-dichlorophenyl)-2-(pyrrolidine-1-carbonylamino)propanoic acid |
| SMILES | O=C(O)[C@@H](Cc1ccc(Cl)cc1Cl)NC(=O)N1CCCC1 |
| InChI | InChI=1S/C14H16Cl2N2O3/c15-10-4-3-9(11(16)8-10)7-12(13(19)20)17-14(21)18-5-1-2-6-18/h3-4,8,12H,1-2,5-7H2,(H,17,21)(H,19,20)/t12-/m1/s1 |
| InChIKey | MXTYPVKTDWXXLC-GFCCVEGCSA-N |
| XLogP | 2.79 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-3-(2,4-dichlorophenyl)-2-(pyrrolidine-1-carbonylamino)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-3-(2,4-dichlorophenyl)-2-(pyrrolidine-1-carbonylamino)propanoic acid?
The IUPAC name of (2R)-3-(2,4-dichlorophenyl)-2-(pyrrolidine-1-carbonylamino)propanoic acid (CID 58221934) is (2R)-3-(2,4-dichlorophenyl)-2-(pyrrolidine-1-carbonylamino)propanoic acid.
What is the SMILES notation for (2R)-3-(2,4-dichlorophenyl)-2-(pyrrolidine-1-carbonylamino)propanoic acid?
The canonical SMILES for (2R)-3-(2,4-dichlorophenyl)-2-(pyrrolidine-1-carbonylamino)propanoic acid is O=C(O)[C@@H](Cc1ccc(Cl)cc1Cl)NC(=O)N1CCCC1.
What is the InChIKey of (2R)-3-(2,4-dichlorophenyl)-2-(pyrrolidine-1-carbonylamino)propanoic acid?
The InChIKey is MXTYPVKTDWXXLC-GFCCVEGCSA-N. The full InChI is InChI=1S/C14H16Cl2N2O3/c15-10-4-3-9(11(16)8-10)7-12(13(19)20)17-14(21)18-5-1-2-6-18/h3-4,8,12H,1-2,5-7H2,(H,17,21)(H,19,20)/t12-/m1/s1.
What are the key properties of (2R)-3-(2,4-dichlorophenyl)-2-(pyrrolidine-1-carbonylamino)propanoic acid?
(2R)-3-(2,4-dichlorophenyl)-2-(pyrrolidine-1-carbonylamino)propanoic acid has a molecular weight of 331.20 g/mol, XLogP of 2.79, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3-(2,4-dichlorophenyl)-2-(pyrrolidine-1-carbonylamino)propanoic acid is sourced from PubChem (CID 58221934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).