About methyl (2R)-3-(2,4-dichlorophenyl)-2-[(3-fluoroazetidine-1-carbonyl)amino]propanoate
methyl (2R)-3-(2,4-dichlorophenyl)-2-[(3-fluoroazetidine-1-carbonyl)amino]propanoate (PubChem CID 58221964) has the molecular formula C14H15Cl2FN2O3
and a molecular weight of 349.19 g/mol. Its IUPAC name is methyl (2R)-3-(2,4-dichlorophenyl)-2-[(3-fluoroazetidine-1-carbonyl)amino]propanoate.
Molecular Properties
| Compound Name | methyl (2R)-3-(2,4-dichlorophenyl)-2-[(3-fluoroazetidine-1-carbonyl)amino]propanoate |
| PubChem CID | 58221964 |
| Molecular Formula | C14H15Cl2FN2O3 |
| Molecular Weight | 349.19 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | methyl (2R)-3-(2,4-dichlorophenyl)-2-[(3-fluoroazetidine-1-carbonyl)amino]propanoate |
| SMILES | COC(=O)[C@@H](Cc1ccc(Cl)cc1Cl)NC(=O)N1CC(F)C1 |
| InChI | InChI=1S/C14H15Cl2FN2O3/c1-22-13(20)12(18-14(21)19-6-10(17)7-19)4-8-2-3-9(15)5-11(8)16/h2-3,5,10,12H,4,6-7H2,1H3,(H,18,21)/t12-/m1/s1 |
| InChIKey | KRTYYOBDDBENDF-GFCCVEGCSA-N |
| XLogP | 2.44 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.19 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl (2R)-3-(2,4-dichlorophenyl)-2-[(3-fluoroazetidine-1-carbonyl)amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R)-3-(2,4-dichlorophenyl)-2-[(3-fluoroazetidine-1-carbonyl)amino]propanoate?
The IUPAC name of methyl (2R)-3-(2,4-dichlorophenyl)-2-[(3-fluoroazetidine-1-carbonyl)amino]propanoate (CID 58221964) is methyl (2R)-3-(2,4-dichlorophenyl)-2-[(3-fluoroazetidine-1-carbonyl)amino]propanoate.
What is the SMILES notation for methyl (2R)-3-(2,4-dichlorophenyl)-2-[(3-fluoroazetidine-1-carbonyl)amino]propanoate?
The canonical SMILES for methyl (2R)-3-(2,4-dichlorophenyl)-2-[(3-fluoroazetidine-1-carbonyl)amino]propanoate is COC(=O)[C@@H](Cc1ccc(Cl)cc1Cl)NC(=O)N1CC(F)C1.
What is the InChIKey of methyl (2R)-3-(2,4-dichlorophenyl)-2-[(3-fluoroazetidine-1-carbonyl)amino]propanoate?
The InChIKey is KRTYYOBDDBENDF-GFCCVEGCSA-N. The full InChI is InChI=1S/C14H15Cl2FN2O3/c1-22-13(20)12(18-14(21)19-6-10(17)7-19)4-8-2-3-9(15)5-11(8)16/h2-3,5,10,12H,4,6-7H2,1H3,(H,18,21)/t12-/m1/s1.
What are the key properties of methyl (2R)-3-(2,4-dichlorophenyl)-2-[(3-fluoroazetidine-1-carbonyl)amino]propanoate?
methyl (2R)-3-(2,4-dichlorophenyl)-2-[(3-fluoroazetidine-1-carbonyl)amino]propanoate has a molecular weight of 349.19 g/mol, XLogP of 2.44, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-3-(2,4-dichlorophenyl)-2-[(3-fluoroazetidine-1-carbonyl)amino]propanoate is sourced from PubChem (CID 58221964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).