C13H24N4O3S — CID 58222790
(2S)-1-(tert-butylamino)-1,1,2-trideuterio-3-[[4-(3,3,5,5-tetradeuteriomorpholin-4-yl)-1,2,5-thiadiazol-3-yl]oxy]propan-2-ol (PubChem CID 58222790) has the molecular formula C13H24N4O3S and a molecular weight of 323.47 g/mol. Its IUPAC name is (2S)-1-(tert-butylamino)-1,1,2-trideuterio-3-[[4-(3,3,5,5-tetradeuteriomorpholin-4-yl)-1,2,5-thiadiazol-3-yl]oxy]propan-2-ol.
| Compound Name | (2S)-1-(tert-butylamino)-1,1,2-trideuterio-3-[[4-(3,3,5,5-tetradeuteriomorpholin-4-yl)-1,2,5-thiadiazol-3-yl]oxy]propan-2-ol |
|---|---|
| PubChem CID | 58222790 |
| Molecular Formula | C13H24N4O3S |
| Molecular Weight | 323.47 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | (2S)-1-(tert-butylamino)-1,1,2-trideuterio-3-[[4-(3,3,5,5-tetradeuteriomorpholin-4-yl)-1,2,5-thiadiazol-3-yl]oxy]propan-2-ol |
| SMILES | [2H]C1([2H])COCC([2H])([2H])N1c1nsnc1OC[C@@]([2H])(O)C([2H])([2H])NC(C)(C)C |
| InChI | InChI=1S/C13H24N4O3S/c1-13(2,3)14-8-10(18)9-20-12-11(15-21-16-12)17-4-6-19-7-5-17/h10,14,18H,4-9H2,1-3H3/t10-/m0/s1/i4D2,5D2,8D2,10D |
| InChIKey | BLJRIMJGRPQVNF-GGRWVWRSSA-N |
| XLogP | 0.50 |
| TPSA | 79.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.47 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |