About (3S)-1-(2,2,2-trifluoroacetyl)pyrrolidine-3-carboxylic acid
(3S)-1-(2,2,2-trifluoroacetyl)pyrrolidine-3-carboxylic acid (PubChem CID 58222841) has the molecular formula C7H8F3NO3
and a molecular weight of 211.14 g/mol. Its IUPAC name is (3S)-1-(2,2,2-trifluoroacetyl)pyrrolidine-3-carboxylic acid.
Molecular Properties
| Compound Name | (3S)-1-(2,2,2-trifluoroacetyl)pyrrolidine-3-carboxylic acid |
| PubChem CID | 58222841 |
| Molecular Formula | C7H8F3NO3 |
| Molecular Weight | 211.14 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | (3S)-1-(2,2,2-trifluoroacetyl)pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCN(C(=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C7H8F3NO3/c8-7(9,10)6(14)11-2-1-4(3-11)5(12)13/h4H,1-3H2,(H,12,13)/t4-/m0/s1 |
| InChIKey | WHYZFERAYJGYDQ-BYPYZUCNSA-N |
| XLogP | 0.48 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.14 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-1-(2,2,2-trifluoroacetyl)pyrrolidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1-(2,2,2-trifluoroacetyl)pyrrolidine-3-carboxylic acid?
The IUPAC name of (3S)-1-(2,2,2-trifluoroacetyl)pyrrolidine-3-carboxylic acid (CID 58222841) is (3S)-1-(2,2,2-trifluoroacetyl)pyrrolidine-3-carboxylic acid.
What is the SMILES notation for (3S)-1-(2,2,2-trifluoroacetyl)pyrrolidine-3-carboxylic acid?
The canonical SMILES for (3S)-1-(2,2,2-trifluoroacetyl)pyrrolidine-3-carboxylic acid is O=C(O)[C@H]1CCN(C(=O)C(F)(F)F)C1.
What is the InChIKey of (3S)-1-(2,2,2-trifluoroacetyl)pyrrolidine-3-carboxylic acid?
The InChIKey is WHYZFERAYJGYDQ-BYPYZUCNSA-N. The full InChI is InChI=1S/C7H8F3NO3/c8-7(9,10)6(14)11-2-1-4(3-11)5(12)13/h4H,1-3H2,(H,12,13)/t4-/m0/s1.
What are the key properties of (3S)-1-(2,2,2-trifluoroacetyl)pyrrolidine-3-carboxylic acid?
(3S)-1-(2,2,2-trifluoroacetyl)pyrrolidine-3-carboxylic acid has a molecular weight of 211.14 g/mol, XLogP of 0.48, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1-(2,2,2-trifluoroacetyl)pyrrolidine-3-carboxylic acid is sourced from PubChem (CID 58222841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).