C26H29N5O — CID 58223084
(14E)-5-ethoxy-20-methylidene-4,6,8,19,28-pentazatetracyclo[19.2.2.210,13.13,7]octacosa-1(23),3(28),4,6,10(27),11,13(26),14,21,24-decaene (PubChem CID 58223084) has the molecular formula C26H29N5O and a molecular weight of 427.55 g/mol. Its IUPAC name is (14E)-5-ethoxy-20-methylidene-4,6,8,19,28-pentazatetracyclo[19.2.2.210,13.13,7]octacosa-1(23),3(28),4,6,10(27),11,13(26),14,21,24-decaene.
| Compound Name | (14E)-5-ethoxy-20-methylidene-4,6,8,19,28-pentazatetracyclo[19.2.2.210,13.13,7]octacosa-1(23),3(28),4,6,10(27),11,13(26),14,21,24-decaene |
|---|---|
| PubChem CID | 58223084 |
| Molecular Formula | C26H29N5O |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | (14E)-5-ethoxy-20-methylidene-4,6,8,19,28-pentazatetracyclo[19.2.2.210,13.13,7]octacosa-1(23),3(28),4,6,10(27),11,13(26),14,21,24-decaene |
| SMILES | C=C1NCCC/C=C/c2ccc(cc2)CNc2nc(nc(OCC)n2)Cc2ccc1cc2 |
| InChI | InChI=1S/C26H29N5O/c1-3-32-26-30-24-17-21-12-14-23(15-13-21)19(2)27-16-6-4-5-7-20-8-10-22(11-9-20)18-28-25(29-24)31-26/h5,7-15,27H,2-4,6,16-18H2,1H3,(H,28,29,30,31)/b7-5+ |
| InChIKey | DERSSGWBUSQTAO-FNORWQNLSA-N |
| XLogP | 4.84 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |