About ethyl 6-(N-carbamoyl-2,6-difluoroanilino)-2-(2,4-difluorophenyl)pyridine-3-carboxylate
ethyl 6-(N-carbamoyl-2,6-difluoroanilino)-2-(2,4-difluorophenyl)pyridine-3-carboxylate (PubChem CID 58223566) has the molecular formula C21H15F4N3O3
and a molecular weight of 433.36 g/mol. Its IUPAC name is ethyl 6-(N-carbamoyl-2,6-difluoroanilino)-2-(2,4-difluorophenyl)pyridine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 6-(N-carbamoyl-2,6-difluoroanilino)-2-(2,4-difluorophenyl)pyridine-3-carboxylate |
| PubChem CID | 58223566 |
| Molecular Formula | C21H15F4N3O3 |
| Molecular Weight | 433.36 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | ethyl 6-(N-carbamoyl-2,6-difluoroanilino)-2-(2,4-difluorophenyl)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(N(C(N)=O)c2c(F)cccc2F)nc1-c1ccc(F)cc1F |
| InChI | InChI=1S/C21H15F4N3O3/c1-2-31-20(29)13-8-9-17(27-18(13)12-7-6-11(22)10-16(12)25)28(21(26)30)19-14(23)4-3-5-15(19)24/h3-10H,2H2,1H3,(H2,26,30) |
| InChIKey | BDUMCJNTWABLOM-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.36 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 6-(N-carbamoyl-2,6-difluoroanilino)-2-(2,4-difluorophenyl)pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-(N-carbamoyl-2,6-difluoroanilino)-2-(2,4-difluorophenyl)pyridine-3-carboxylate?
The IUPAC name of ethyl 6-(N-carbamoyl-2,6-difluoroanilino)-2-(2,4-difluorophenyl)pyridine-3-carboxylate (CID 58223566) is ethyl 6-(N-carbamoyl-2,6-difluoroanilino)-2-(2,4-difluorophenyl)pyridine-3-carboxylate.
What is the SMILES notation for ethyl 6-(N-carbamoyl-2,6-difluoroanilino)-2-(2,4-difluorophenyl)pyridine-3-carboxylate?
The canonical SMILES for ethyl 6-(N-carbamoyl-2,6-difluoroanilino)-2-(2,4-difluorophenyl)pyridine-3-carboxylate is CCOC(=O)c1ccc(N(C(N)=O)c2c(F)cccc2F)nc1-c1ccc(F)cc1F.
What is the InChIKey of ethyl 6-(N-carbamoyl-2,6-difluoroanilino)-2-(2,4-difluorophenyl)pyridine-3-carboxylate?
The InChIKey is BDUMCJNTWABLOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15F4N3O3/c1-2-31-20(29)13-8-9-17(27-18(13)12-7-6-11(22)10-16(12)25)28(21(26)30)19-14(23)4-3-5-15(19)24/h3-10H,2H2,1H3,(H2,26,30).
What are the key properties of ethyl 6-(N-carbamoyl-2,6-difluoroanilino)-2-(2,4-difluorophenyl)pyridine-3-carboxylate?
ethyl 6-(N-carbamoyl-2,6-difluoroanilino)-2-(2,4-difluorophenyl)pyridine-3-carboxylate has a molecular weight of 433.36 g/mol, XLogP of 4.70, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-(N-carbamoyl-2,6-difluoroanilino)-2-(2,4-difluorophenyl)pyridine-3-carboxylate is sourced from PubChem (CID 58223566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).