C18H29NO3 — CID 58223638
(Z)-N-[(2R,3R,5S,6S)-2,5-dimethyl-6-[(E)-3-methyl-4-oxobut-2-enyl]oxan-3-yl]-4-methylpent-2-enamide (PubChem CID 58223638) has the molecular formula C18H29NO3 and a molecular weight of 307.43 g/mol. Its IUPAC name is (Z)-N-[(2R,3R,5S,6S)-2,5-dimethyl-6-[(E)-3-methyl-4-oxobut-2-enyl]oxan-3-yl]-4-methylpent-2-enamide.
| Compound Name | (Z)-N-[(2R,3R,5S,6S)-2,5-dimethyl-6-[(E)-3-methyl-4-oxobut-2-enyl]oxan-3-yl]-4-methylpent-2-enamide |
|---|---|
| PubChem CID | 58223638 |
| Molecular Formula | C18H29NO3 |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | (Z)-N-[(2R,3R,5S,6S)-2,5-dimethyl-6-[(E)-3-methyl-4-oxobut-2-enyl]oxan-3-yl]-4-methylpent-2-enamide |
| SMILES | C/C(C=O)=C\C[C@@H]1O[C@H](C)[C@H](NC(=O)/C=C\C(C)C)C[C@@H]1C |
| InChI | InChI=1S/C18H29NO3/c1-12(2)6-9-18(21)19-16-10-14(4)17(22-15(16)5)8-7-13(3)11-20/h6-7,9,11-12,14-17H,8,10H2,1-5H3,(H,19,21)/b9-6-,13-7+/t14-,15+,16+,17-/m0/s1 |
| InChIKey | AMOVUNGGEAGCKM-XDAZQPCHSA-N |
| XLogP | 3.03 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|