C19H31NO2 — CID 58223646
(Z)-N-[(2R,3R,5S,6S)-2,5-dimethyl-6-[(2E)-3-methylpenta-2,4-dienyl]oxan-3-yl]-4-methylpent-2-enamide (PubChem CID 58223646) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is (Z)-N-[(2R,3R,5S,6S)-2,5-dimethyl-6-[(2E)-3-methylpenta-2,4-dienyl]oxan-3-yl]-4-methylpent-2-enamide.
| Compound Name | (Z)-N-[(2R,3R,5S,6S)-2,5-dimethyl-6-[(2E)-3-methylpenta-2,4-dienyl]oxan-3-yl]-4-methylpent-2-enamide |
|---|---|
| PubChem CID | 58223646 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | (Z)-N-[(2R,3R,5S,6S)-2,5-dimethyl-6-[(2E)-3-methylpenta-2,4-dienyl]oxan-3-yl]-4-methylpent-2-enamide |
| SMILES | C=C/C(C)=C/C[C@@H]1O[C@H](C)[C@H](NC(=O)/C=C\C(C)C)C[C@@H]1C |
| InChI | InChI=1S/C19H31NO2/c1-7-14(4)9-10-18-15(5)12-17(16(6)22-18)20-19(21)11-8-13(2)3/h7-9,11,13,15-18H,1,10,12H2,2-6H3,(H,20,21)/b11-8-,14-9+/t15-,16+,17+,18-/m0/s1 |
| InChIKey | PNBCNHZDRQWAAU-VEHHIXETSA-N |
| XLogP | 4.02 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|